2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide
Modify Date: 2026-08-29 11:38:36
![2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide Structure](https://www.chemsrc.com/extcaspic/460/1574494-67-9.png)
2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide structure
|
Common Name | 2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1574494-67-9 | Molecular Weight | 329.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15N3OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H15N3OS2 |
|---|---|
| Molecular Weight | 329.4 |
| InChIKey | NAKVNFRHQCEWTL-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2ccccc2)c(C(=O)NCCc2nccs2)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide? |
| A: SMILES notation of 2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide is Cc1nc(-c2ccccc2)c(C(=O)NCCc2nccs2)s1. |
| Q: What is the CAS number of 2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide? |
| A: CAS number of 2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide is 1574494-67-9. |
| Q: What is the InChIKey of 2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide? |
| A: InChIKey of 2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide is NAKVNFRHQCEWTL-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide? |
| A: Molecular weight of 2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide is 329.4. |
| Q: What is the Chinese name of 1574494-67-9? |
| A: Chinese name of 1574494-67-9 is 1574494-67-9. |
| Q: What is the molecular formula of 2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide? |
| A: Molecular formula of 2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide is C16H15N3OS2. |
| Q: What is the English name of 2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide? |
| A: The English name of 2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide is 2-methyl-4-phenyl-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-thiazole-5-carboxamide. |