N-(1-{2-[4-(3-methoxyphenyl)piperazino]-2-oxoethyl}-1H-indol-4-yl)acetamide structure
|
Common Name | N-(1-{2-[4-(3-methoxyphenyl)piperazino]-2-oxoethyl}-1H-indol-4-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 1574495-26-3 | Molecular Weight | 406.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H26N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(1-{2-[4-(3-methoxyphenyl)piperazino]-2-oxoethyl}-1H-indol-4-yl)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H26N4O3 |
|---|---|
| Molecular Weight | 406.5 |
| InChIKey | WVHBNGGKTAKWTB-UHFFFAOYSA-N |
| SMILES | COc1cccc(N2CCN(C(=O)Cn3ccc4c(NC(C)=O)cccc43)CC2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-(1-{2-[4-(3-methoxyphenyl)piperazino]-2-oxoethyl}-1H-indol-4-yl)acetamide? |
| A: Molecular formula of N-(1-{2-[4-(3-methoxyphenyl)piperazino]-2-oxoethyl}-1H-indol-4-yl)acetamide is C23H26N4O3. |
| Q: What is the SMILES notation of N-(1-{2-[4-(3-methoxyphenyl)piperazino]-2-oxoethyl}-1H-indol-4-yl)acetamide? |
| A: SMILES notation of N-(1-{2-[4-(3-methoxyphenyl)piperazino]-2-oxoethyl}-1H-indol-4-yl)acetamide is COc1cccc(N2CCN(C(=O)Cn3ccc4c(NC(C)=O)cccc43)CC2)c1. |
| Q: What is the Chinese name of 1574495-26-3? |
| A: Chinese name of 1574495-26-3 is 1574495-26-3. |
| Q: What is the molecular weight of N-(1-{2-[4-(3-methoxyphenyl)piperazino]-2-oxoethyl}-1H-indol-4-yl)acetamide? |
| A: Molecular weight of N-(1-{2-[4-(3-methoxyphenyl)piperazino]-2-oxoethyl}-1H-indol-4-yl)acetamide is 406.5. |
| Q: What is the English name of N-(1-{2-[4-(3-methoxyphenyl)piperazino]-2-oxoethyl}-1H-indol-4-yl)acetamide? |
| A: The English name of N-(1-{2-[4-(3-methoxyphenyl)piperazino]-2-oxoethyl}-1H-indol-4-yl)acetamide is N-(1-{2-[4-(3-methoxyphenyl)piperazino]-2-oxoethyl}-1H-indol-4-yl)acetamide. |
| Q: What is the InChIKey of N-(1-{2-[4-(3-methoxyphenyl)piperazino]-2-oxoethyl}-1H-indol-4-yl)acetamide? |
| A: InChIKey of N-(1-{2-[4-(3-methoxyphenyl)piperazino]-2-oxoethyl}-1H-indol-4-yl)acetamide is WVHBNGGKTAKWTB-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-(1-{2-[4-(3-methoxyphenyl)piperazino]-2-oxoethyl}-1H-indol-4-yl)acetamide? |
| A: CAS number of N-(1-{2-[4-(3-methoxyphenyl)piperazino]-2-oxoethyl}-1H-indol-4-yl)acetamide is 1574495-26-3. |