methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate
Modify Date: 2026-07-24 19:04:17
![methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate Structure](https://www.chemsrc.com/extcaspic/159/1574495-39-8.png)
methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate structure
|
Common Name | methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate | ||
|---|---|---|---|---|
| CAS Number | 1574495-39-8 | Molecular Weight | 289.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15N3O4 |
|---|---|
| Molecular Weight | 289.29 |
| InChIKey | AEAQYLSEXNOYSN-UHFFFAOYSA-N |
| SMILES | COC(=O)CNC(=O)CCc1nc(-c2ccccc2)no1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate? |
| A: SMILES notation of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate is COC(=O)CNC(=O)CCc1nc(-c2ccccc2)no1. |
| Q: What is the CAS number of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate? |
| A: CAS number of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate is 1574495-39-8. |
| Q: What is the Chinese name of 1574495-39-8? |
| A: Chinese name of 1574495-39-8 is 1574495-39-8. |
| Q: What is the InChIKey of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate? |
| A: InChIKey of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate is AEAQYLSEXNOYSN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate? |
| A: Molecular weight of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate is 289.29. |
| Q: What is the molecular formula of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate? |
| A: Molecular formula of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate is C14H15N3O4. |
| Q: What is the English name of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate? |
| A: The English name of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate is methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]glycinate. |