diethyl benzylpiperazinomethylphosphonate structure
|
Common Name | diethyl benzylpiperazinomethylphosphonate | ||
|---|---|---|---|---|
| CAS Number | 157524-19-1 | Molecular Weight | 326.37100 | |
| Density | 1.122g/cm3 | Boiling Point | 426.3ºC at 760mmHg | |
| Molecular Formula | C16H27N2O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.6ºC | |
| Name | 1-benzyl-4-(diethoxyphosphorylmethyl)piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.122g/cm3 |
|---|---|
| Boiling Point | 426.3ºC at 760mmHg |
| Molecular Formula | C16H27N2O3P |
| Molecular Weight | 326.37100 |
| Flash Point | 211.6ºC |
| Exact Mass | 326.17600 |
| PSA | 51.82000 |
| LogP | 2.90360 |
| Vapour Pressure | 1.78E-07mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | CPQDHKDKVMESSV-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CN1CCN(Cc2ccccc2)CC1)OCC |
|
~%
diethyl benzylp... CAS#:157524-19-1 |
| Literature: Chaudhary, Preeti; Kumar, Rupesh; Verma, Akhilesh K.; Singh, Devender; Yadav, Vibha; Chhillar, Anil K.; Sharma; Chandra, Ramesh Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 6 p. 1819 - 1826 |
|
~%
diethyl benzylp... CAS#:157524-19-1 |
| Literature: Boehringer Ingelheim Pharma KG Patent: US6972288 B1, 2005 ; Location in patent: Page/Page column 73 ; US 6972288 B1 |
|
~%
diethyl benzylp... CAS#:157524-19-1 |
| Literature: Chaudhary, Preeti; Kumar, Rupesh; Verma, Akhilesh K.; Singh, Devender; Yadav, Vibha; Chhillar, Anil K.; Sharma; Chandra, Ramesh Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 6 p. 1819 - 1826 |
| Diethyl benzylpiperazinomethylphosphonate |
| diethyl[(4-benzylpiperazin-1-yl)methyl]phosphonate |
| DBPMP |