2-Naphthalenesulfonamide,N-phenyl- structure
|
Common Name | 2-Naphthalenesulfonamide,N-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1576-48-3 | Molecular Weight | 283.34500 | |
| Density | 1.332g/cm3 | Boiling Point | 474.5ºC at 760 mmHg | |
| Molecular Formula | C16H13NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.8ºC | |
| Name | N-phenylnaphthalene-2-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.332g/cm3 |
|---|---|
| Boiling Point | 474.5ºC at 760 mmHg |
| Molecular Formula | C16H13NO2S |
| Molecular Weight | 283.34500 |
| Flash Point | 240.8ºC |
| Exact Mass | 283.06700 |
| PSA | 54.55000 |
| LogP | 4.79440 |
| Vapour Pressure | 3.59E-09mmHg at 25°C |
| Index of Refraction | 1.692 |
| InChIKey | NOZMNLZEWDUBJT-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Nc1ccccc1)c1ccc2ccccc2c1 |
| HS Code | 2935009090 |
|---|
|
~92%
2-Naphthalenesu... CAS#:1576-48-3 |
| Literature: Nyasse, Barthelemy; Grehn, Leif; Maia, Hernani L.S.; Monteiro, Luis S.; Ragnarsson, Ulf Journal of Organic Chemistry, 1999 , vol. 64, # 19 p. 7135 - 7139 |
|
~89%
2-Naphthalenesu... CAS#:1576-48-3 |
| Literature: Teo, Yong-Chua; Yong, Fui-Fong Synlett, 2011 , # 6 p. 837 - 843 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Naphthalin-sulfonsaeure-(2)-anilid |
| naphthalene-2-sulfonic acid phenylamide |
| Naphthalin-2-sulfonanilid |
| naphthalene-2-sulfonanilide |
| 2-Naphthalenesulfonanilide |
| N-Phenyl-naphthalin-2-sulfonamid |
| 2-Naphthalenesulfonamide,N-phenyl |