Crocacin A structure
|
Common Name | Crocacin A | ||
|---|---|---|---|---|
| CAS Number | 157698-34-5 | Molecular Weight | 538.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H42N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Crocacin A |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C31H42N2O6 |
|---|---|
| Molecular Weight | 538.7 |
| InChIKey | XHTUDGVBJDVOEZ-PSXYSELWSA-N |
| SMILES | C[C@@H](/C=C/C(=C/C(=O)N/C=C\C/C=C\C(=O)NCC(=O)OC)/C)[C@@H]([C@H](C)[C@H](/C=C/C1=CC=CC=C1)OC)OC |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of cytochrome bc1 complex in bovine heart mitochondria by NADH oxidase ass...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1008029
|
|
Name: Inhibition of Plasmopara viticola cytochrome bc1 complex inoculated in vine plant ass...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1008027
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Crocacin A? |
| A: The English name of Crocacin A is Crocacin A. |
| Q: What is the InChIKey of Crocacin A? |
| A: InChIKey of Crocacin A is XHTUDGVBJDVOEZ-PSXYSELWSA-N. |
| Q: What is the CAS number of Crocacin A? |
| A: CAS number of Crocacin A is 157698-34-5. |
| Q: What is the molecular weight of Crocacin A? |
| A: Molecular weight of Crocacin A is 538.7. |
| Q: What is the molecular formula of Crocacin A? |
| A: Molecular formula of Crocacin A is C31H42N2O6. |
| Q: What is the Chinese name of 157698-34-5? |
| A: Chinese name of 157698-34-5 is 157698-34-5. |
| Q: What is the SMILES notation of Crocacin A? |
| A: SMILES notation of Crocacin A is C[C@@H](/C=C/C(=C/C(=O)N/C=C\C/C=C\C(=O)NCC(=O)OC)/C)[C@@H]([C@H](C)[C@H](/C=C/C1=CC=CC=C1)OC)OC. |