Crocacin A
Modify Date: 2026-03-18 09:53:17
Crocacin A structure
|
Common Name | Crocacin A | ||
|---|---|---|---|---|
| CAS Number | 157698-34-5 | Molecular Weight | 538.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H42N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Crocacin A |
|---|
| Molecular Formula | C31H42N2O6 |
|---|---|
| Molecular Weight | 538.7 |
| InChIKey | XHTUDGVBJDVOEZ-PSXYSELWSA-N |
| SMILES | C[C@@H](/C=C/C(=C/C(=O)N/C=C\C/C=C\C(=O)NCC(=O)OC)/C)[C@@H]([C@H](C)[C@H](/C=C/C1=CC=CC=C1)OC)OC |
|
Name: Inhibition of cytochrome bc1 complex in bovine heart mitochondria by NADH oxidase ass...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1008029
|
|
Name: Inhibition of Plasmopara viticola cytochrome bc1 complex inoculated in vine plant ass...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1008027
|
Total 2, Current Page 1 of 1
1