potassium,(2S,3R,4R)-2,3,4,5-tetrahydroxypentanoate structure
|
Common Name | potassium,(2S,3R,4R)-2,3,4,5-tetrahydroxypentanoate | ||
|---|---|---|---|---|
| CAS Number | 15770-22-6 | Molecular Weight | 204.22000 | |
| Density | N/A | Boiling Point | 584ºC at 760 mmHg | |
| Molecular Formula | C5H9KO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 321ºC | |
| Name | potassium,(2S,3R,4R)-2,3,4,5-tetrahydroxypentanoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 584ºC at 760 mmHg |
|---|---|
| Molecular Formula | C5H9KO6 |
| Molecular Weight | 204.22000 |
| Flash Point | 321ºC |
| Exact Mass | 204.00400 |
| PSA | 121.05000 |
| Vapour Pressure | 4.53E-16mmHg at 25°C |
| InChIKey | HSMKJRYJAZFMNP-PSRPMNHMSA-M |
| SMILES | O=C([O-])C(O)C(O)C(O)CO.[K+] |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| potassium arabinonate |
| EINECS 239-863-5 |
| potassium arabonate |
| D-Arabinonic acid,monopotassium salt |
| potassium D-arabinonate |
| D-arabinonic acid,potassium-salt |
| D-Arabinonsaeure,Kalium-Salz |
| potassium D-arabonate |
| Kalium-arabinonat |