N-[3-(Triethylsilyl)propyl]furfurylamine structure
|
Common Name | N-[3-(Triethylsilyl)propyl]furfurylamine | ||
|---|---|---|---|---|
| CAS Number | 1578-43-4 | Molecular Weight | 253.45600 | |
| Density | 0.899g/cm3 | Boiling Point | 300.7ºC at 760 mmHg | |
| Molecular Formula | C14H27NOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.7ºC | |
| Name | N-(furan-2-ylmethyl)-3-triethylsilylpropan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.899g/cm3 |
|---|---|
| Boiling Point | 300.7ºC at 760 mmHg |
| Molecular Formula | C14H27NOSi |
| Molecular Weight | 253.45600 |
| Flash Point | 135.7ºC |
| Exact Mass | 253.18600 |
| PSA | 25.17000 |
| LogP | 4.65870 |
| Vapour Pressure | 0.0011mmHg at 25°C |
| Index of Refraction | 1.462 |
| InChIKey | MNGWCBICXBZNJT-UHFFFAOYSA-N |
| SMILES | CC[Si](CC)(CC)CCCNCc1ccco1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| FURFURYLAMINE,N-(3-TRIETHYLSILYLPROPYL) |
| (3-Furfurylaminopropyl)triethylsilane |
| Silane,(3-furfurylaminopropyl)triethyl |
| furfuryl-(3-triethylsilanyl-propyl)-amine |