6,7-dimethoxy-2-(4-prop-2-enylpiperazin-1-yl)quinazolin-4-amine structure
|
Common Name | 6,7-dimethoxy-2-(4-prop-2-enylpiperazin-1-yl)quinazolin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 15793-38-1 | Molecular Weight | 329.39700 | |
| Density | 1.207g/cm3 | Boiling Point | 525.9ºC at 760mmHg | |
| Molecular Formula | C17H23N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.9ºC | |
| Name | 6,7-dimethoxy-2-(4-prop-2-enylpiperazin-1-yl)quinazolin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 525.9ºC at 760mmHg |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.39700 |
| Flash Point | 271.9ºC |
| Exact Mass | 329.18500 |
| PSA | 76.74000 |
| LogP | 2.12130 |
| Vapour Pressure | 3.75E-11mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | HSIPLPKNLDWHSE-UHFFFAOYSA-N |
| SMILES | C=CCN1CCN(c2nc(N)c3cc(OC)c(OC)cc3n2)CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| quinazosin |
| unii-436xk6qfmr |