4-epianhydrochlortetracycline hydrochloride, can be used as secondary standard structure
|
Common Name | 4-epianhydrochlortetracycline hydrochloride, can be used as secondary standard | ||
|---|---|---|---|---|
| CAS Number | 158018-53-2 | Molecular Weight | 497.32500 | |
| Density | N/A | Boiling Point | 623ºC at 760 mmHg | |
| Molecular Formula | C22H22Cl2N2O7 | Melting Point | 222ºC | |
| MSDS | N/A | Flash Point | 330.6ºC | |
| Name | (4R,4aS,12aR)-7-chloro-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 623ºC at 760 mmHg |
|---|---|
| Melting Point | 222ºC |
| Molecular Formula | C22H22Cl2N2O7 |
| Molecular Weight | 497.32500 |
| Flash Point | 330.6ºC |
| Exact Mass | 496.08000 |
| PSA | 161.39000 |
| LogP | 2.61150 |
| Appearance of Characters | Powder | Orange |
| Vapour Pressure | 2.21E-16mmHg at 25°C |
| InChIKey | ISGAAFMBTIWTEU-PXAZKYFKSA-N |
| SMILES | Cc1c2c(c(O)c3c(O)ccc(Cl)c13)C(=O)C1(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C1C2.Cl |
| Storage condition | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| 4-Epianhydrochlortetracycline HCl |
| 4-Epianhydrochlortetracycline Hydrochloride |