2,4-Pentanedione,3-[(2-hydroxyphenyl)methylene]- structure
|
Common Name | 2,4-Pentanedione,3-[(2-hydroxyphenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 15809-22-0 | Molecular Weight | 204.22200 | |
| Density | 1.184g/cm3 | Boiling Point | 421.1ºC at 760mmHg | |
| Molecular Formula | C12H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.6ºC | |
| Name | 3-[(2-hydroxyphenyl)methylidene]pentane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.184g/cm3 |
|---|---|
| Boiling Point | 421.1ºC at 760mmHg |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22200 |
| Flash Point | 222.6ºC |
| Exact Mass | 204.07900 |
| PSA | 54.37000 |
| LogP | 1.95360 |
| Vapour Pressure | 1.09E-07mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | DDMYUHBSCSXTAY-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=Cc1ccccc1O)C(C)=O |
| HS Code | 2914400090 |
|---|
|
~85%
2,4-Pentanedion... CAS#:15809-22-0 |
| Literature: Sumathi, S.; Tharmaraj, P.; Anitha, C.; Sheela, C. D. Spectrochimica Acta, Part A: Molecular and Biomolecular Spectroscopy, 2012 , vol. 97, p. 377 - 383,7 |
|
~0%
2,4-Pentanedion... CAS#:15809-22-0 |
| Literature: Zonouzi; Googheri, M. Sadeghi; Miralinaghi Organic Preparations and Procedures International, 2008 , vol. 40, # 5 p. 471 - 477 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 3-salicylidineacetylacetone |
| 3-salicylideneacetylacetone |
| 1,1-Diacetyl-2-o-hydroxyphenyl-ethylen |
| 3-Salicyliden-pentan-2,4-dion |
| 3-(2-Hydroxy-benzyliden)-pentan-2,4-dion |
| 3-(2-hydroxybenzylidene)pentane-2,4-dione |