Methanone,dicyclopropyl-, (dicyclopropylmethylene)hydrazone (9CI)
Modify Date: 2025-09-29 18:04:39
Methanone,dicyclopropyl-, (dicyclopropylmethylene)hydrazone (9CI) structure
|
Common Name | Methanone,dicyclopropyl-, (dicyclopropylmethylene)hydrazone (9CI) | ||
|---|---|---|---|---|
| CAS Number | 15813-18-0 | Molecular Weight | 216.32200 | |
| Density | 1.41g/cm3 | Boiling Point | 320.1ºC at 760 mmHg | |
| Molecular Formula | C14H20N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.4ºC | |
| Name | 1,1-dicyclopropyl-N-(dicyclopropylmethylideneamino)methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 320.1ºC at 760 mmHg |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.32200 |
| Flash Point | 139.4ºC |
| Exact Mass | 216.16300 |
| PSA | 24.72000 |
| LogP | 3.42340 |
| Vapour Pressure | 0.00061mmHg at 25°C |
| Index of Refraction | 1.758 |
| InChIKey | UXXLOISWPSNDGR-UHFFFAOYSA-N |
| SMILES | C1CC1C(=NN=C(C1CC1)C1CC1)C1CC1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| dicyclopropyl ketazine |
| Dicyclopropylketonazin |
| bis-dicyclopropylmethylene-hydrazine |