octanoic acid, compound with dicyclohexylamine (1:1) structure
|
Common Name | octanoic acid, compound with dicyclohexylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 15816-71-4 | Molecular Weight | 325.52900 | |
| Density | N/A | Boiling Point | 466.8ºC at 760 mmHg | |
| Molecular Formula | C20H39NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.1ºC | |
| Name | N-cyclohexylcyclohexanamine,octanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 466.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H39NO2 |
| Molecular Weight | 325.52900 |
| Flash Point | 236.1ºC |
| Exact Mass | 325.29800 |
| PSA | 49.33000 |
| LogP | 6.06380 |
| Vapour Pressure | 5.25E-10mmHg at 25°C |
| InChIKey | HFNYKMJSBDPKSF-UHFFFAOYSA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.CCCCCCCC(=O)O |
| Vaden 100E |
| EINECS 239-914-1 |
| Octanoic acid,compound with dicyclohexylamine (1:1) |