(1-(Ethylsulfonyl)piperidin-2-yl)methanamine hydrochloride
Modify Date: 2026-07-15 13:30:17
(1-(Ethylsulfonyl)piperidin-2-yl)methanamine hydrochloride structure
|
Common Name | (1-(Ethylsulfonyl)piperidin-2-yl)methanamine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1581629-30-2 | Molecular Weight | 242.77 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H19ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1-(Ethylsulfonyl)piperidin-2-yl)methanamine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H19ClN2O2S |
|---|---|
| Molecular Weight | 242.77 |
| InChIKey | BJUINMFPBJWKAA-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)N1CCCCC1CN.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1581629-30-2? |
| A: Chinese name of 1581629-30-2 is 1581629-30-2. |
| Q: What is the English name of (1-(Ethylsulfonyl)piperidin-2-yl)methanamine hydrochloride? |
| A: The English name of (1-(Ethylsulfonyl)piperidin-2-yl)methanamine hydrochloride is (1-(Ethylsulfonyl)piperidin-2-yl)methanamine hydrochloride. |
| Q: What is the InChIKey of (1-(Ethylsulfonyl)piperidin-2-yl)methanamine hydrochloride? |
| A: InChIKey of (1-(Ethylsulfonyl)piperidin-2-yl)methanamine hydrochloride is BJUINMFPBJWKAA-UHFFFAOYSA-N. |
| Q: What is the molecular formula of (1-(Ethylsulfonyl)piperidin-2-yl)methanamine hydrochloride? |
| A: Molecular formula of (1-(Ethylsulfonyl)piperidin-2-yl)methanamine hydrochloride is C8H19ClN2O2S. |
| Q: What is the molecular weight of (1-(Ethylsulfonyl)piperidin-2-yl)methanamine hydrochloride? |
| A: Molecular weight of (1-(Ethylsulfonyl)piperidin-2-yl)methanamine hydrochloride is 242.77. |
| Q: What is the SMILES notation of (1-(Ethylsulfonyl)piperidin-2-yl)methanamine hydrochloride? |
| A: SMILES notation of (1-(Ethylsulfonyl)piperidin-2-yl)methanamine hydrochloride is CCS(=O)(=O)N1CCCCC1CN.Cl. |
| Q: What is the CAS number of (1-(Ethylsulfonyl)piperidin-2-yl)methanamine hydrochloride? |
| A: CAS number of (1-(Ethylsulfonyl)piperidin-2-yl)methanamine hydrochloride is 1581629-30-2. |