2-Pentafluorophenyl-malonic acid diethyl ester structure
|
Common Name | 2-Pentafluorophenyl-malonic acid diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1582-05-4 | Molecular Weight | 326.21600 | |
| Density | 1.397g/cm3 | Boiling Point | 282.132ºC at 760 mmHg | |
| Molecular Formula | C13H11F5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.598ºC | |
| Name | diethyl 2-(2,3,4,5,6-pentafluorophenyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.397g/cm3 |
|---|---|
| Boiling Point | 282.132ºC at 760 mmHg |
| Molecular Formula | C13H11F5O4 |
| Molecular Weight | 326.21600 |
| Flash Point | 120.598ºC |
| Exact Mass | 326.05800 |
| PSA | 52.60000 |
| LogP | 2.59190 |
| Vapour Pressure | 0.003mmHg at 25°C |
| Index of Refraction | 1.448 |
| InChIKey | ILXWVDXADPLRDY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)c1c(F)c(F)c(F)c(F)c1F |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EC-000.1817 |
| Diethyl pentafluorophenyl-malonate |
| Pentafluorphenylmalonester |
| Pentafluorphenylmalonsaeurediethylester |
| Pentafluorphenylmalonsaeure-diaethylester |
| 2-Pentafluorophenyl-malonic acid diethyl ester |
| diethyl 2-(2,3,4,5,6-pentafluorophenyl)malonate |
| Diethyl 2-(perfluorophenyl)malonate |