2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride
Modify Date: 2026-09-20 09:17:59
![2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride Structure](https://www.chemsrc.com/extcaspic/233/1582206-29-8.png)
2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride structure
|
Common Name | 2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1582206-29-8 | Molecular Weight | 360.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16Cl3N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16Cl3N3O |
|---|---|
| Molecular Weight | 360.7 |
| InChIKey | GSTQSPUDNXGVLJ-UHFFFAOYSA-N |
| SMILES | CCNCc1ccccc1NC(=O)c1cc(Cl)nc(Cl)c1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride? |
| A: InChIKey of 2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride is GSTQSPUDNXGVLJ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1582206-29-8? |
| A: Chinese name of 1582206-29-8 is 1582206-29-8. |
| Q: What is the SMILES notation of 2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride? |
| A: SMILES notation of 2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride is CCNCc1ccccc1NC(=O)c1cc(Cl)nc(Cl)c1.Cl. |
| Q: What is the CAS number of 2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride? |
| A: CAS number of 2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride is 1582206-29-8. |
| Q: What is the molecular weight of 2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride? |
| A: Molecular weight of 2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride is 360.7. |
| Q: What is the English name of 2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride? |
| A: The English name of 2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride is 2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride. |
| Q: What is the molecular formula of 2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride? |
| A: Molecular formula of 2,6-dichloro-N-{2-[(ethylamino)methyl]phenyl}pyridine-4-carboxamide hydrochloride is C15H16Cl3N3O. |