2,2-bis[[(1-oxopentyl)oxy]methyl]propane-1,3-diyl divalerate structure
|
Common Name | 2,2-bis[[(1-oxopentyl)oxy]methyl]propane-1,3-diyl divalerate | ||
|---|---|---|---|---|
| CAS Number | 15834-04-5 | Molecular Weight | 472.61200 | |
| Density | 1.038g/cm3 | Boiling Point | 528.3ºC at 760mmHg | |
| Molecular Formula | C25H44O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.4ºC | |
| Name | [3-pentanoyloxy-2,2-bis(pentanoyloxymethyl)propyl] pentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.038g/cm3 |
|---|---|
| Boiling Point | 528.3ºC at 760mmHg |
| Molecular Formula | C25H44O8 |
| Molecular Weight | 472.61200 |
| Flash Point | 220.4ºC |
| Exact Mass | 472.30400 |
| PSA | 105.20000 |
| LogP | 4.90640 |
| Vapour Pressure | 3.01E-11mmHg at 25°C |
| Index of Refraction | 1.461 |
| InChIKey | ZQYCVIGMGPFQQS-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)OCC(COC(=O)CCCC)(COC(=O)CCCC)COC(=O)CCCC |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 2,2-Bis(((1-oxopentyl)oxy)methyl)-1,3-propanediyl pentanoate |
| Pentaerythritol tetrabutyrate |
| tetra-O-valeryl-pentaerythritol |
| Pentaerythrol tetrapentanoate |
| pentaerythritol tetrapentanoate ester |
| 2,2-BIS[[(1-OXOPENTYL)OXY]METHYL]PROPANE-1,3-DIYL DIVALERATE |
| EINECS 239-937-7 |
| pentaerythritol tetrapetanoate |
| Pentaerythritol tetravalerate |