aPKCI structure
|
Common Name | aPKCI | ||
|---|---|---|---|---|
| CAS Number | 15854-12-3 | Molecular Weight | 307.36500 | |
| Density | 1.234g/cm3 | Boiling Point | 437.3ºC at 760mmHg | |
| Molecular Formula | C15H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.3ºC | |
Use of aPKCIaPKC-I is an inhibitor of atypical protein kinase C (aPKC ) which inhibits both PKCζ and PKCι with high specificity and prevents VEGF-induced endothelial permeability in cell culture and in vivo, thereby blocking ischemia-reperfusion (IR)-induced permeability. |
| Name | Ethyl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate |
|---|
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 437.3ºC at 760mmHg |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.36500 |
| Flash Point | 218.3ºC |
| Exact Mass | 307.08800 |
| PSA | 99.02000 |
| LogP | 3.77240 |
| Vapour Pressure | 7.54E-08mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | OZWGHIQPWZHYPG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)c(OC)c2)csc1N |
| HS Code | 2934999090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |