1,6-Dimethyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecaphenylhexasilane
Modify Date: 2025-10-08 12:19:17
1,6-Dimethyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecaphenylhexasilane structure
|
Common Name | 1,6-Dimethyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecaphenylhexasilane | ||
|---|---|---|---|---|
| CAS Number | 1586-77-2 | Molecular Weight | 1123.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C74H66Si6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,6-Dimethyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecaphenylhexasilane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C74H66Si6 |
|---|---|
| Molecular Weight | 1123.8 |
| InChIKey | YJSNGWVIFOZTFF-UHFFFAOYSA-N |
| SMILES | C[Si](c1ccccc1)(c1ccccc1)[Si](c1ccccc1)(c1ccccc1)[Si](c1ccccc1)(c1ccccc1)[Si](c1ccccc1)(c1ccccc1)[Si](c1ccccc1)(c1ccccc1)[Si](C)(c1ccccc1)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,6-Dimethyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecaphenylhexasilane? |
| A: InChIKey of 1,6-Dimethyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecaphenylhexasilane is YJSNGWVIFOZTFF-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,6-Dimethyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecaphenylhexasilane? |
| A: CAS number of 1,6-Dimethyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecaphenylhexasilane is 1586-77-2. |
| Q: What is the molecular weight of 1,6-Dimethyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecaphenylhexasilane? |
| A: Molecular weight of 1,6-Dimethyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecaphenylhexasilane is 1123.8. |
| Q: What is the SMILES notation of 1,6-Dimethyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecaphenylhexasilane? |
| A: SMILES notation of 1,6-Dimethyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecaphenylhexasilane is C[Si](c1ccccc1)(c1ccccc1)[Si](c1ccccc1)(c1ccccc1)[Si](c1ccccc1)(c1ccccc1)[Si](c1ccccc1)(c1ccccc1)[Si](c1ccccc1)(c1ccccc1)[Si](C)(c1ccccc1)c1ccccc1. |
| Q: What is the molecular formula of 1,6-Dimethyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecaphenylhexasilane? |
| A: Molecular formula of 1,6-Dimethyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecaphenylhexasilane is C74H66Si6. |
| Q: What is the English name of 1,6-Dimethyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecaphenylhexasilane? |
| A: The English name of 1,6-Dimethyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecaphenylhexasilane is 1,6-Dimethyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecaphenylhexasilane. |
| Q: What is the Chinese name of 1586-77-2? |
| A: Chinese name of 1586-77-2 is 1586-77-2. |