2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone
2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone structure
|
Common Name | 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 158641-52-2 | Molecular Weight | 277.08700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10BrFO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-Bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone (Chinese name: 2-溴-1-(2-氟-4,5-二甲氧基苯基)乙酮，CAS number: 158641-52-2)，molecular formula C10H10BrFO3，molecular weight 277.087. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10BrFO3 |
|---|---|
| Molecular Weight | 277.08700 |
| Exact Mass | 275.98000 |
| PSA | 35.53000 |
| LogP | 2.42050 |
| InChIKey | UAYLCJRZFYQDGH-UHFFFAOYSA-N |
| SMILES | COc1cc(F)c(C(=O)CBr)cc1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone? |
| A: Polar surface area (PSA) of 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone is 35.53000. |
| Q: What is the SMILES notation of 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone? |
| A: SMILES notation of 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone is COc1cc(F)c(C(=O)CBr)cc1OC. |
| Q: What is the English name of 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone? |
| A: The English name of 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone is 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone. |
| Q: What is the molecular formula of 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone? |
| A: Molecular formula of 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone is C10H10BrFO3. |
| Q: What is the CAS number of 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone? |
| A: CAS number of 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone is 158641-52-2. |
| Q: What is the Chinese name of 158641-52-2? |
| A: Chinese name of 158641-52-2 is 158641-52-2. |
| Q: What is the molecular weight of 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone? |
| A: Molecular weight of 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone is 277.08700. |
| Q: What is the InChIKey of 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone? |
| A: InChIKey of 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone is UAYLCJRZFYQDGH-UHFFFAOYSA-N. |
| Q: What is the LogP of 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone? |
| A: LogP of 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)ethanone is 2.42050. |