Phosphoric acid diisopropyl 1-(piperidinomethyl)ethyl ester structure
|
Common Name | Phosphoric acid diisopropyl 1-(piperidinomethyl)ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 15870-42-5 | Molecular Weight | 307.36600 | |
| Density | 1.041g/cm3 | Boiling Point | 367.1ºC at 760mmHg | |
| Molecular Formula | C14H30NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.8ºC | |
| Name | 1-piperidin-1-ylpropan-2-yl dipropan-2-yl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.041g/cm3 |
|---|---|
| Boiling Point | 367.1ºC at 760mmHg |
| Molecular Formula | C14H30NO4P |
| Molecular Weight | 307.36600 |
| Flash Point | 175.8ºC |
| Exact Mass | 307.19100 |
| PSA | 57.81000 |
| LogP | 3.77340 |
| Vapour Pressure | 1.4E-05mmHg at 25°C |
| Index of Refraction | 1.457 |
| InChIKey | CIMGFDPFMIWLTH-UHFFFAOYSA-N |
| SMILES | CC(C)OP(=O)(OC(C)C)OC(C)CN1CCCCC1 |
| DS-32 |
| Phosphoric acid,diisopropyl ester,ester with 1-methyl-2-piperidinoethanol |
| Phosphoric acid,diisopropyl 1-methyl-2-piperidinoethyl ester (8CI) |
| N-[2-(O,O-Diisopropyl-phosphonooxy)-propyl]-piperidin |
| Diisopropyl (1-piperidino-2-propyl) phosphate |
| Phosphoric acid,diisopropyl(1-piperidino-2-propyl) ester |