(2-Piperidino-1-methylethyl)dibutyl=phosphate structure
|
Common Name | (2-Piperidino-1-methylethyl)dibutyl=phosphate | ||
|---|---|---|---|---|
| CAS Number | 15870-43-6 | Molecular Weight | 335.41900 | |
| Density | 1.024g/cm3 | Boiling Point | 405.4ºC at 760 mmHg | |
| Molecular Formula | C16H34NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199ºC | |
| Name | dibutyl 1-piperidin-1-ylpropan-2-yl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.024g/cm3 |
|---|---|
| Boiling Point | 405.4ºC at 760 mmHg |
| Molecular Formula | C16H34NO4P |
| Molecular Weight | 335.41900 |
| Flash Point | 199ºC |
| Exact Mass | 335.22300 |
| PSA | 57.81000 |
| LogP | 4.55680 |
| Vapour Pressure | 8.81E-07mmHg at 25°C |
| Index of Refraction | 1.46 |
| InChIKey | JXWDIKAQTDFWJT-UHFFFAOYSA-N |
| SMILES | CCCCOP(=O)(OCCCC)OC(C)CN1CCCCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Dibutyl (1-piperidino-2-propyl) phosphate |
| dibutyl 1-(piperidin-1-yl)propan-2-yl phosphate |
| DS-28 |
| Phosphoric acid,dibutyl ester,ester with 1-methyl-2-piperidinoethanol |
| N-[2-(O,O-Dibutyl-phosphonooxy)-propyl]-piperidin |
| Phosphoric acid,dibutyl (1-piperidino-2-propyl) ester |