Pralmorelin structure
|
Common Name | Pralmorelin | ||
|---|---|---|---|---|
| CAS Number | 158861-67-7 | Molecular Weight | 746.89700 | |
| Density | 1.27 g/cm3 | Boiling Point | 1265.3ºC at 760 mmHg | |
| Molecular Formula | C42H50N8O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 719ºC | |
Use of PralmorelinPralmorelin (free base) stimulates growth hormone secretion. |
| Name | Pralmorelin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27 g/cm3 |
|---|---|
| Boiling Point | 1265.3ºC at 760 mmHg |
| Molecular Formula | C42H50N8O5 |
| Molecular Weight | 746.89700 |
| Flash Point | 719ºC |
| Exact Mass | 746.39000 |
| PSA | 227.32000 |
| LogP | 5.91420 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | HRNLPPBUBKMZMT-RDRUQFPZSA-N |
| SMILES | CC(N)C(=O)NC(Cc1ccc2ccccc2c1)C(=O)NC(C)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCCN)C(N)=O |
| Storage condition | −20°C |
| WGK Germany | 3 |
|---|
| GHRP-2 ACETATE |
| GHRP-2 |
| (2S,5R,8S,11S,14R,17R)-17-amino-2-(4-aminobutyl)-5-benzyl-8-(1H-indol-3-ylmethyl)-11-methyl-14-(naphthalen-2-ylmethyl)-4,7,10,13,16-pentaoxo-3,6,9,12,15-pentaazaoctadecan-1-amide (non-preferred name) |
| Growth hormone-releasing peptide 2 |
| 4-dichloro-1 |
| D-Alanyl-3-(2-naphthalenyl)-D-alanyl-L-alanyl-L-tryptophyl-D-phenylalanyl-L-lysinamide |
| Pralmorelin |
| 4]triazolo[4 |
| GHRP 2 |
| MFCD05663458 |
| 6-dihydro-[1 |
| L-Lysinamide, D-alanyl-3-(2-naphthalenyl)-D-alanyl-L-alanyl-L-tryptophyl-D-phenylalanyl- |
| CHRP-2 |
| D-alanyl-3-(2-naphthyl)-D-alanyl-L-alanyl-L-tryptophyl-D-phenylalanyl-L-lysinaamide dihydrochloride |
| GHCA |
| D-Alanyl-3-(2-naphthyl)-D-alanyl-L-alanyl-L-tryptophyl-D-phenylalanyl-L-lysinamide |
| Tributyl(2-(2 |