SPDP-C6-NHS ester structure
|
Common Name | SPDP-C6-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 158913-22-5 | Molecular Weight | 425.52200 | |
| Density | 1.36g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H23N3O5S2 | Melting Point | 82-84ºC | |
| MSDS | USA | Flash Point | N/A | |
Use of SPDP-C6-NHS esterSPDP-C6-NHS ester is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | (2,5-dioxopyrrolidin-1-yl) 6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoate |
|---|---|
| Synonym | More Synonyms |
| Description | SPDP-C6-NHS ester is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.36g/cm3 |
|---|---|
| Melting Point | 82-84ºC |
| Molecular Formula | C18H23N3O5S2 |
| Molecular Weight | 425.52200 |
| Exact Mass | 425.10800 |
| PSA | 156.27000 |
| LogP | 2.82460 |
| Index of Refraction | 1.61 |
| InChIKey | QYEAAMBIUQLHFQ-UHFFFAOYSA-N |
| SMILES | O=C(CCSSc1ccccn1)NCCCCCC(=O)ON1C(=O)CCC1=O |
| lc-spdp |
| spdph |
| bicl208 |