4-[(Dimethylamino)methylene]-1-phenyl-3-propyl-2-pyrazolin-5-one structure
|
Common Name | 4-[(Dimethylamino)methylene]-1-phenyl-3-propyl-2-pyrazolin-5-one | ||
|---|---|---|---|---|
| CAS Number | 15900-09-1 | Molecular Weight | 257.33100 | |
| Density | 1.08g/cm3 | Boiling Point | 341.2ºC at 760 mmHg | |
| Molecular Formula | C15H19N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.2ºC | |
| Name | (4E)-4-(dimethylaminomethylidene)-2-phenyl-5-propylpyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 341.2ºC at 760 mmHg |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.33100 |
| Flash Point | 160.2ºC |
| Exact Mass | 257.15300 |
| PSA | 35.91000 |
| LogP | 2.13540 |
| Vapour Pressure | 8.17E-05mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | CUWKTMCUQYDTED-ACCUITESSA-N |
| SMILES | CCCC1=NN(c2ccccc2)C(=O)C1=CN(C)C |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(dimethylamino-methylene)-2-phenyl-5-propyl-2,4-dihydro-pyrazol-3-one |
| 4-Dimethylaminomethylene-1-phenyl-3-propyl-2-pyrazolin-5-one |
| 2-Pyrazolin-5-one,4-dimethylaminomethylene-1-phenyl-3-propyl |