2,4,6-TRIS(PROP-2-YN-1-YLOXY)-1,3,5-TRIAZINE structure
|
Common Name | 2,4,6-TRIS(PROP-2-YN-1-YLOXY)-1,3,5-TRIAZINE | ||
|---|---|---|---|---|
| CAS Number | 15911-93-0 | Molecular Weight | 243.21800 | |
| Density | 1.27g/cm3 | Boiling Point | 378.8ºC at 760 mmHg | |
| Molecular Formula | C12H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.8ºC | |
| Name | 2,4,6-tris(prop-2-ynoxy)-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 378.8ºC at 760 mmHg |
| Molecular Formula | C12H9N3O3 |
| Molecular Weight | 243.21800 |
| Flash Point | 137.8ºC |
| Exact Mass | 243.06400 |
| PSA | 66.36000 |
| Vapour Pressure | 1.34E-05mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | DRFJNVUYUQQIDX-UHFFFAOYSA-N |
| SMILES | C#CCOc1nc(OCC#C)nc(OCC#C)n1 |
| HS Code | 2933699090 |
|---|
|
~91%
2,4,6-TRIS(PROP... CAS#:15911-93-0 |
| Literature: GLYCAN BIOSCIENCES PTY LTD; KETT, Warren, Charles; CHEN, Yugang Patent: WO2010/37179 A1, 2010 ; Location in patent: Page/Page column 80 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| HMS2288D23 |
| 2,4,6-tripropargyloxy-1,3,5-triazine |