2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]-N,N-dimethylethanamine structure
|
Common Name | 2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]-N,N-dimethylethanamine | ||
|---|---|---|---|---|
| CAS Number | 15917-50-7 | Molecular Weight | 357.48800 | |
| Density | 1.052g/cm3 | Boiling Point | 469.9ºC at 760mmHg | |
| Molecular Formula | C25H27NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.7ºC | |
| Name | 2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.052g/cm3 |
|---|---|
| Boiling Point | 469.9ºC at 760mmHg |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.48800 |
| Flash Point | 136.7ºC |
| Exact Mass | 357.20900 |
| PSA | 12.47000 |
| LogP | 5.60600 |
| Vapour Pressure | 5.31E-09mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | YBZBQYHSLRTDHL-QQTULTPQSA-N |
| SMILES | CC(=C(c1ccccc1)c1ccc(OCCN(C)C)cc1)c1ccccc1 |
|
~%
2-[4-[(Z)-1,2-d... CAS#:15917-50-7 |
| Literature: Brown, S. David; Armstrong, Robert W. Journal of Organic Chemistry, 1997 , vol. 62, # 21 p. 7076 - 7077 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| tamoxifen C-methyl derivative |