9-fluoro-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole structure
|
Common Name | 9-fluoro-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole | ||
|---|---|---|---|---|
| CAS Number | 15918-85-1 | Molecular Weight | 204.24300 | |
| Density | 1.225g/cm3 | Boiling Point | 374.4ºC at 760 mmHg | |
| Molecular Formula | C12H13FN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.2ºC | |
| Name | 9-fluoro-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 374.4ºC at 760 mmHg |
| Molecular Formula | C12H13FN2 |
| Molecular Weight | 204.24300 |
| Flash Point | 180.2ºC |
| Exact Mass | 204.10600 |
| PSA | 27.82000 |
| LogP | 2.32400 |
| Vapour Pressure | 8.37E-06mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | PAOLJJUVRCDQAE-UHFFFAOYSA-N |
| SMILES | Fc1ccc2[nH]c3c(c2c1)CCNCC3 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9-fluoro-1,2,3,4,5,6-hexahydro-azepino[4,5-b]indole |
| AZEPINO(4,5-b)INDOLE,9-FLUORO-1,2,3,4,5,6-HEXAHYDRO |
| 9-Fluor-1,2,3,4,5,6-hexahydro-azepino<4,5-b>indol |
| Azepino(4,5-b)indole,1,2,3,4,5,6-hexahydro-9-fluoro |