Phosphorothioic acid O,O-dimethyl O-(3-isopropyl-4-nitrophenyl) ester structure
|
Common Name | Phosphorothioic acid O,O-dimethyl O-(3-isopropyl-4-nitrophenyl) ester | ||
|---|---|---|---|---|
| CAS Number | 1592-82-1 | Molecular Weight | 305.28700 | |
| Density | 1.29g/cm3 | Boiling Point | 382.1ºC at 760 mmHg | |
| Molecular Formula | C11H16NO5PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.9ºC | |
| Name | dimethoxy-(4-nitro-3-propan-2-ylphenoxy)-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 382.1ºC at 760 mmHg |
| Molecular Formula | C11H16NO5PS |
| Molecular Weight | 305.28700 |
| Flash Point | 184.9ºC |
| Exact Mass | 305.04900 |
| PSA | 115.41000 |
| LogP | 4.78810 |
| Vapour Pressure | 1.06E-05mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | MPCILJQVDVSLSZ-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)Oc1ccc([N+](=O)[O-])c(C(C)C)c1 |
| HS Code | 2920190090 |
|---|
| HS Code | 2920190090 |
|---|---|
| Summary | 2920190090 other thiophosphoric esters (phosphorothioates) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| O,O-Dimethyl O-(3-isopropyl-4-nitrophenyl)phosphorothioate |
| Phosphorothioic acid,O,O-dimethyl O-(3-isopropyl-4-nitrophenyl) ester |
| o,o-dimethyl o-[4-nitro-3-(propan-2-yl)phenyl] phosphorothioate |