1,4-Dichloro-2-iodo-3-(4,4,4-trifluorobutoxy)butane
Modify Date: 2026-07-08 19:07:59
1,4-Dichloro-2-iodo-3-(4,4,4-trifluorobutoxy)butane structure
|
Common Name | 1,4-Dichloro-2-iodo-3-(4,4,4-trifluorobutoxy)butane | ||
|---|---|---|---|---|
| CAS Number | 1592452-99-7 | Molecular Weight | 378.98 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H12Cl2F3IO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-Dichloro-2-iodo-3-(4,4,4-trifluorobutoxy)butane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H12Cl2F3IO |
|---|---|
| Molecular Weight | 378.98 |
| InChIKey | NNAUCYPVDHJMKK-UHFFFAOYSA-N |
| SMILES | FC(F)(F)CCCOC(CCl)C(I)CCl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,4-Dichloro-2-iodo-3-(4,4,4-trifluorobutoxy)butane? |
| A: Molecular weight of 1,4-Dichloro-2-iodo-3-(4,4,4-trifluorobutoxy)butane is 378.98. |
| Q: What is the molecular formula of 1,4-Dichloro-2-iodo-3-(4,4,4-trifluorobutoxy)butane? |
| A: Molecular formula of 1,4-Dichloro-2-iodo-3-(4,4,4-trifluorobutoxy)butane is C8H12Cl2F3IO. |
| Q: What is the CAS number of 1,4-Dichloro-2-iodo-3-(4,4,4-trifluorobutoxy)butane? |
| A: CAS number of 1,4-Dichloro-2-iodo-3-(4,4,4-trifluorobutoxy)butane is 1592452-99-7. |
| Q: What is the English name of 1,4-Dichloro-2-iodo-3-(4,4,4-trifluorobutoxy)butane? |
| A: The English name of 1,4-Dichloro-2-iodo-3-(4,4,4-trifluorobutoxy)butane is 1,4-Dichloro-2-iodo-3-(4,4,4-trifluorobutoxy)butane. |
| Q: What is the Chinese name of 1592452-99-7? |
| A: Chinese name of 1592452-99-7 is 1592452-99-7. |
| Q: What is the SMILES notation of 1,4-Dichloro-2-iodo-3-(4,4,4-trifluorobutoxy)butane? |
| A: SMILES notation of 1,4-Dichloro-2-iodo-3-(4,4,4-trifluorobutoxy)butane is FC(F)(F)CCCOC(CCl)C(I)CCl. |
| Q: What is the InChIKey of 1,4-Dichloro-2-iodo-3-(4,4,4-trifluorobutoxy)butane? |
| A: InChIKey of 1,4-Dichloro-2-iodo-3-(4,4,4-trifluorobutoxy)butane is NNAUCYPVDHJMKK-UHFFFAOYSA-N. |