2-Bromo-1,4-dichloro-3-(3,3-dimethylbutoxy)butane
Modify Date: 2026-07-04 12:14:50
2-Bromo-1,4-dichloro-3-(3,3-dimethylbutoxy)butane structure
|
Common Name | 2-Bromo-1,4-dichloro-3-(3,3-dimethylbutoxy)butane | ||
|---|---|---|---|---|
| CAS Number | 1592542-44-3 | Molecular Weight | 306.06 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H19BrCl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Bromo-1,4-dichloro-3-(3,3-dimethylbutoxy)butane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H19BrCl2O |
|---|---|
| Molecular Weight | 306.06 |
| InChIKey | XSPZHDLMSOOTNH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CCOC(CCl)C(Br)CCl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-Bromo-1,4-dichloro-3-(3,3-dimethylbutoxy)butane? |
| A: InChIKey of 2-Bromo-1,4-dichloro-3-(3,3-dimethylbutoxy)butane is XSPZHDLMSOOTNH-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-Bromo-1,4-dichloro-3-(3,3-dimethylbutoxy)butane? |
| A: CAS number of 2-Bromo-1,4-dichloro-3-(3,3-dimethylbutoxy)butane is 1592542-44-3. |
| Q: What is the molecular formula of 2-Bromo-1,4-dichloro-3-(3,3-dimethylbutoxy)butane? |
| A: Molecular formula of 2-Bromo-1,4-dichloro-3-(3,3-dimethylbutoxy)butane is C10H19BrCl2O. |
| Q: What is the SMILES notation of 2-Bromo-1,4-dichloro-3-(3,3-dimethylbutoxy)butane? |
| A: SMILES notation of 2-Bromo-1,4-dichloro-3-(3,3-dimethylbutoxy)butane is CC(C)(C)CCOC(CCl)C(Br)CCl. |
| Q: What is the molecular weight of 2-Bromo-1,4-dichloro-3-(3,3-dimethylbutoxy)butane? |
| A: Molecular weight of 2-Bromo-1,4-dichloro-3-(3,3-dimethylbutoxy)butane is 306.06. |
| Q: What is the Chinese name of 1592542-44-3? |
| A: Chinese name of 1592542-44-3 is 1592542-44-3. |
| Q: What is the English name of 2-Bromo-1,4-dichloro-3-(3,3-dimethylbutoxy)butane? |
| A: The English name of 2-Bromo-1,4-dichloro-3-(3,3-dimethylbutoxy)butane is 2-Bromo-1,4-dichloro-3-(3,3-dimethylbutoxy)butane. |