6,8-Dibromo-2-oxo-1,2-dihydroquinoline-3-carboxylic acid
Modify Date: 2026-09-05 12:17:46
6,8-Dibromo-2-oxo-1,2-dihydroquinoline-3-carboxylic acid structure
|
Common Name | 6,8-Dibromo-2-oxo-1,2-dihydroquinoline-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1592808-44-0 | Molecular Weight | 346.96 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H5Br2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6,8-Dibromo-2-oxo-1,2-dihydroquinoline-3-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H5Br2NO3 |
|---|---|
| Molecular Weight | 346.96 |
| InChIKey | APKBQXXAYFKIPO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc2cc(Br)cc(Br)c2[nH]c1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 6,8-Dibromo-2-oxo-1,2-dihydroquinoline-3-carboxylic acid? |
| A: CAS number of 6,8-Dibromo-2-oxo-1,2-dihydroquinoline-3-carboxylic acid is 1592808-44-0. |
| Q: What is the English name of 6,8-Dibromo-2-oxo-1,2-dihydroquinoline-3-carboxylic acid? |
| A: The English name of 6,8-Dibromo-2-oxo-1,2-dihydroquinoline-3-carboxylic acid is 6,8-Dibromo-2-oxo-1,2-dihydroquinoline-3-carboxylic acid. |
| Q: What is the InChIKey of 6,8-Dibromo-2-oxo-1,2-dihydroquinoline-3-carboxylic acid? |
| A: InChIKey of 6,8-Dibromo-2-oxo-1,2-dihydroquinoline-3-carboxylic acid is APKBQXXAYFKIPO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6,8-Dibromo-2-oxo-1,2-dihydroquinoline-3-carboxylic acid? |
| A: Molecular formula of 6,8-Dibromo-2-oxo-1,2-dihydroquinoline-3-carboxylic acid is C10H5Br2NO3. |
| Q: What is the molecular weight of 6,8-Dibromo-2-oxo-1,2-dihydroquinoline-3-carboxylic acid? |
| A: Molecular weight of 6,8-Dibromo-2-oxo-1,2-dihydroquinoline-3-carboxylic acid is 346.96. |
| Q: What is the SMILES notation of 6,8-Dibromo-2-oxo-1,2-dihydroquinoline-3-carboxylic acid? |
| A: SMILES notation of 6,8-Dibromo-2-oxo-1,2-dihydroquinoline-3-carboxylic acid is O=C(O)c1cc2cc(Br)cc(Br)c2[nH]c1=O. |
| Q: What is the Chinese name of 1592808-44-0? |
| A: Chinese name of 1592808-44-0 is 1592808-44-0. |