1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine
Modify Date: 2026-07-31 11:49:06
![1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine Structure](https://www.chemsrc.com/extcaspic/244/1592950-86-1.png)
1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine structure
|
Common Name | 1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine | ||
|---|---|---|---|---|
| CAS Number | 1592950-86-1 | Molecular Weight | 195.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H17N3O |
|---|---|
| Molecular Weight | 195.26 |
| InChIKey | VTPSFFBOWJVRAG-UHFFFAOYSA-N |
| SMILES | CC1(C)CCC(Cn2cc(N)cn2)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine? |
| A: The English name of 1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine is 1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine. |
| Q: What is the Chinese name of 1592950-86-1? |
| A: Chinese name of 1592950-86-1 is 1592950-86-1. |
| Q: What is the molecular weight of 1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine? |
| A: Molecular weight of 1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine is 195.26. |
| Q: What is the CAS number of 1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine? |
| A: CAS number of 1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine is 1592950-86-1. |
| Q: What is the molecular formula of 1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine? |
| A: Molecular formula of 1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine is C10H17N3O. |
| Q: What is the SMILES notation of 1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine? |
| A: SMILES notation of 1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine is CC1(C)CCC(Cn2cc(N)cn2)O1. |
| Q: What is the InChIKey of 1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine? |
| A: InChIKey of 1-[(5,5-dimethyloxolan-2-yl)methyl]-1H-pyrazol-4-amine is VTPSFFBOWJVRAG-UHFFFAOYSA-N. |