N-benzylpropan-2-imine oxide structure
|
Common Name | N-benzylpropan-2-imine oxide | ||
|---|---|---|---|---|
| CAS Number | 159330-32-2 | Molecular Weight | 163.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-benzylpropan-2-imine oxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13NO |
|---|---|
| Molecular Weight | 163.21600 |
| Exact Mass | 163.10000 |
| PSA | 28.75000 |
| LogP | 2.70090 |
| InChIKey | MYHZGWGVVFFRBN-UHFFFAOYSA-N |
| SMILES | CC(C)=[N+]([O-])Cc1ccccc1 |
|
~65%
N-benzylpropan-... CAS#:159330-32-2 |
| Literature: Ohtake, Hiroaki; Imada, Yasushi; Murahashi, Shun-Ichi Bulletin of the Chemical Society of Japan, 1999 , vol. 72, # 12 p. 2737 - 2754 |
|
~11%
N-benzylpropan-... CAS#:159330-32-2 |
| Literature: Yamazaki, Shigekazu Bulletin of the Chemical Society of Japan, 1997 , vol. 70, # 4 p. 877 - 883 |
|
~10%
N-benzylpropan-... CAS#:159330-32-2 |
| Literature: Franco; Merchan; Merino; Tejero Synthetic Communications, 1995 , vol. 25, # 15 p. 2275 - 2284 |
| benzyl(1-methylethylidene)azane oxide |
| N-isopropylidenebenzylamine N-oxide |
| Benzenemethanamine,N-(1-methylethylidene)-,N-oxide |
| N-benzyl-1-methylethylideneamine N-oxide |
| N-(1-methylethylidene)benzylamine N-oxide |
| N-benzyl-propan-2-imine oxide |