4-(Bromomethyl)-4-(4,4,4-trifluorobutoxy)oxane
Modify Date: 2025-08-26 18:31:39
4-(Bromomethyl)-4-(4,4,4-trifluorobutoxy)oxane structure
|
Common Name | 4-(Bromomethyl)-4-(4,4,4-trifluorobutoxy)oxane | ||
|---|---|---|---|---|
| CAS Number | 1593466-55-7 | Molecular Weight | 305.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16BrF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(Bromomethyl)-4-(4,4,4-trifluorobutoxy)oxane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16BrF3O2 |
|---|---|
| Molecular Weight | 305.13 |
| InChIKey | RLMHFUJQGUQLQD-UHFFFAOYSA-N |
| SMILES | FC(F)(F)CCCOC1(CBr)CCOCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-(Bromomethyl)-4-(4,4,4-trifluorobutoxy)oxane? |
| A: CAS number of 4-(Bromomethyl)-4-(4,4,4-trifluorobutoxy)oxane is 1593466-55-7. |
| Q: What is the molecular formula of 4-(Bromomethyl)-4-(4,4,4-trifluorobutoxy)oxane? |
| A: Molecular formula of 4-(Bromomethyl)-4-(4,4,4-trifluorobutoxy)oxane is C10H16BrF3O2. |
| Q: What is the SMILES notation of 4-(Bromomethyl)-4-(4,4,4-trifluorobutoxy)oxane? |
| A: SMILES notation of 4-(Bromomethyl)-4-(4,4,4-trifluorobutoxy)oxane is FC(F)(F)CCCOC1(CBr)CCOCC1. |
| Q: What is the Chinese name of 1593466-55-7? |
| A: Chinese name of 1593466-55-7 is 1593466-55-7. |
| Q: What is the molecular weight of 4-(Bromomethyl)-4-(4,4,4-trifluorobutoxy)oxane? |
| A: Molecular weight of 4-(Bromomethyl)-4-(4,4,4-trifluorobutoxy)oxane is 305.13. |
| Q: What is the InChIKey of 4-(Bromomethyl)-4-(4,4,4-trifluorobutoxy)oxane? |
| A: InChIKey of 4-(Bromomethyl)-4-(4,4,4-trifluorobutoxy)oxane is RLMHFUJQGUQLQD-UHFFFAOYSA-N. |
| Q: What is the English name of 4-(Bromomethyl)-4-(4,4,4-trifluorobutoxy)oxane? |
| A: The English name of 4-(Bromomethyl)-4-(4,4,4-trifluorobutoxy)oxane is 4-(Bromomethyl)-4-(4,4,4-trifluorobutoxy)oxane. |