carboxyibuprofen structure
|
Common Name | carboxyibuprofen | ||
|---|---|---|---|---|
| CAS Number | 15935-54-3 | Molecular Weight | 236.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O4 | Melting Point | 114-116ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of carboxyibuprofenIbuprofen carboxylic acid is a major metabolite of ibuprofen. |
| Name | Ibuprofen Carboxylic Acid |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 114-116ºC |
|---|---|
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.26400 |
| Exact Mass | 236.10500 |
| PSA | 74.60000 |
| LogP | 2.13790 |
| InChIKey | DIVLBIVDYADZPL-UHFFFAOYSA-N |
| SMILES | CC(Cc1ccc(C(C)C(=O)O)cc1)C(=O)O |
| Storage condition | -20°C Freezer |
| HS Code | 2917399090 |
|---|
|
~%
carboxyibuprofen CAS#:15935-54-3 |
| Literature: Journal of Pharmacology and Experimental Therapeutics, , vol. 337, # 3 p. 876 - 886 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-[4-(2-Carboxypropyl)phenyl]propionic acid 3-[4-(1-Carboxyethyl)phenyl]-2-methylpropionic acid |
| Carboxyibuprofen |
| 3-[4-(1-carboxyethyl)phenyl]-2-methylpropanoic acid |