5-Chloro-7-methyl-1H-indole-3-carbaldehyde structure
|
Common Name | 5-Chloro-7-methyl-1H-indole-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 15936-83-1 | Molecular Weight | 193.630 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 378.4±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H8ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.6±26.5 °C | |
| Name | 5-Chloro-7-methyl-1H-indole-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 378.4±37.0 °C at 760 mmHg |
| Molecular Formula | C10H8ClNO |
| Molecular Weight | 193.630 |
| Flash Point | 182.6±26.5 °C |
| Exact Mass | 193.029449 |
| PSA | 32.86000 |
| LogP | 2.93 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.703 |
| InChIKey | UTPKFSUXDCWZKF-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)cc2c(C=O)c[nH]c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-chloro-7-methyl-indole-3-carbaldehyde |
| 5-Chloro-7-methyl-indole-3-carboxaldehyde |
| 5-Chloro-7-methyl-1H-indole-3-carbaldehyde |
| 5-chloro-7-methyl-1H-indole-3-carboxaldehyde |
| 1H-Indole-3-carboxaldehyde, 5-chloro-7-methyl- |
| 5-Chlor-7-methyl-indol-3-carbaldehyd |