1-Naphthalenol,4-[2-[2-methyl-4-[2-(2-methylphenyl)diazenyl]phenyl]diazenyl]- structure
|
Common Name | 1-Naphthalenol,4-[2-[2-methyl-4-[2-(2-methylphenyl)diazenyl]phenyl]diazenyl]- | ||
|---|---|---|---|---|
| CAS Number | 1594-01-0 | Molecular Weight | 380.44200 | |
| Density | 1.19g/cm3 | Boiling Point | 574ºC at 760mmHg | |
| Molecular Formula | C24H20N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301ºC | |
| Name | (4Z)-4-[[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]hydrazinylidene]naphthalen-1-one |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 574ºC at 760mmHg |
| Molecular Formula | C24H20N4O |
| Molecular Weight | 380.44200 |
| Flash Point | 301ºC |
| Exact Mass | 380.16400 |
| PSA | 69.67000 |
| LogP | 7.99300 |
| Vapour Pressure | 3.51E-13mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | NRXZKGUYCKGZKF-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1N=Nc1ccc(N=Nc2ccc(O)c3ccccc23)c(C)c1 |
|
~%
1-Naphthalenol,... CAS#:1594-01-0 |
| Literature: May; Hunt Industrial and Engineering Chemistry, 1928 , vol. 20, p. 385,386 Chem. Zentralbl., 1928 , vol. 99, # I p. 2995 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |