[3,5-bis(4-tert-butylbenzoyl)phenyl]-(4-tert-butylphenyl)methanone structure
|
Common Name | [3,5-bis(4-tert-butylbenzoyl)phenyl]-(4-tert-butylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 159424-07-4 | Molecular Weight | 558.74900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H42O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3,5-bis(4-tert-butylbenzoyl)phenyl]-(4-tert-butylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C39H42O3 |
|---|---|
| Molecular Weight | 558.74900 |
| Exact Mass | 558.31300 |
| PSA | 51.21000 |
| LogP | 9.27210 |
| InChIKey | DXOFOBDSAYBYRA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)c2cc(C(=O)c3ccc(C(C)(C)C)cc3)cc(C(=O)c3ccc(C(C)(C)C)cc3)c2)cc1 |
|
~61%
[3,5-bis(4-tert... CAS#:159424-07-4 |
| Literature: Wienk, Martijn M.; Janssen, Rene A. J. Journal of the American Chemical Society, 1997 , vol. 119, # 23 p. 5398 - 5403 |
| Methanone,1,3,5-benzenetriyltris[[4-(1,1-dimethylethyl)phenyl] |