{2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene
Modify Date: 2025-09-10 07:15:22
![{2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene Structure](https://www.chemsrc.com/extcaspic/275/1594460-09-9.png)
{2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene structure
|
Common Name | {2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene | ||
|---|---|---|---|---|
| CAS Number | 1594460-09-9 | Molecular Weight | 344.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12F3IO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12F3IO |
|---|---|
| Molecular Weight | 344.11 |
| InChIKey | SKVCQVFZZPXZOS-UHFFFAOYSA-N |
| SMILES | CC(OC(CI)c1ccccc1)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of {2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene? |
| A: Molecular weight of {2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene is 344.11. |
| Q: What is the CAS number of {2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene? |
| A: CAS number of {2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene is 1594460-09-9. |
| Q: What is the molecular formula of {2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene? |
| A: Molecular formula of {2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene is C11H12F3IO. |
| Q: What is the SMILES notation of {2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene? |
| A: SMILES notation of {2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene is CC(OC(CI)c1ccccc1)C(F)(F)F. |
| Q: What is the English name of {2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene? |
| A: The English name of {2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene is {2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene. |
| Q: What is the Chinese name of 1594460-09-9? |
| A: Chinese name of 1594460-09-9 is 1594460-09-9. |
| Q: What is the InChIKey of {2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene? |
| A: InChIKey of {2-Iodo-1-[(1,1,1-trifluoropropan-2-yl)oxy]ethyl}benzene is SKVCQVFZZPXZOS-UHFFFAOYSA-N. |