1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene
Modify Date: 2025-09-10 07:50:09
![1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene Structure](https://www.chemsrc.com/extcaspic/449/1594649-01-0.png)
1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene structure
|
Common Name | 1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene | ||
|---|---|---|---|---|
| CAS Number | 1594649-01-0 | Molecular Weight | 399.06 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16BrIO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16BrIO2 |
|---|---|
| Molecular Weight | 399.06 |
| InChIKey | LTFACFJJKZJUJY-UHFFFAOYSA-N |
| SMILES | COCC(C)OC(CI)c1cccc(Br)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene? |
| A: The English name of 1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene is 1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene. |
| Q: What is the molecular weight of 1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene? |
| A: Molecular weight of 1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene is 399.06. |
| Q: What is the Chinese name of 1594649-01-0? |
| A: Chinese name of 1594649-01-0 is 1594649-01-0. |
| Q: What is the InChIKey of 1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene? |
| A: InChIKey of 1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene is LTFACFJJKZJUJY-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene? |
| A: Molecular formula of 1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene is C12H16BrIO2. |
| Q: What is the CAS number of 1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene? |
| A: CAS number of 1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene is 1594649-01-0. |
| Q: What is the SMILES notation of 1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene? |
| A: SMILES notation of 1-Bromo-3-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene is COCC(C)OC(CI)c1cccc(Br)c1. |