4,6-Dichloroimidazo[1,5-a]quinoxaline structure
|
Common Name | 4,6-Dichloroimidazo[1,5-a]quinoxaline | ||
|---|---|---|---|---|
| CAS Number | 1594792-70-7 | Molecular Weight | 238.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H5Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,6-Dichloroimidazo[1,5-a]quinoxaline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H5Cl2N3 |
|---|---|
| Molecular Weight | 238.07 |
| InChIKey | MWODDHRVIJRNFC-UHFFFAOYSA-N |
| SMILES | Clc1cccc2c1nc(Cl)c1cncn12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4,6-Dichloroimidazo[1,5-a]quinoxaline? |
| A: Molecular formula of 4,6-Dichloroimidazo[1,5-a]quinoxaline is C10H5Cl2N3. |
| Q: What is the English name of 4,6-Dichloroimidazo[1,5-a]quinoxaline? |
| A: The English name of 4,6-Dichloroimidazo[1,5-a]quinoxaline is 4,6-Dichloroimidazo[1,5-a]quinoxaline. |
| Q: What is the InChIKey of 4,6-Dichloroimidazo[1,5-a]quinoxaline? |
| A: InChIKey of 4,6-Dichloroimidazo[1,5-a]quinoxaline is MWODDHRVIJRNFC-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1594792-70-7? |
| A: Chinese name of 1594792-70-7 is 1594792-70-7. |
| Q: What is the SMILES notation of 4,6-Dichloroimidazo[1,5-a]quinoxaline? |
| A: SMILES notation of 4,6-Dichloroimidazo[1,5-a]quinoxaline is Clc1cccc2c1nc(Cl)c1cncn12. |
| Q: What is the CAS number of 4,6-Dichloroimidazo[1,5-a]quinoxaline? |
| A: CAS number of 4,6-Dichloroimidazo[1,5-a]quinoxaline is 1594792-70-7. |
| Q: What is the molecular weight of 4,6-Dichloroimidazo[1,5-a]quinoxaline? |
| A: Molecular weight of 4,6-Dichloroimidazo[1,5-a]quinoxaline is 238.07. |