1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane
Modify Date: 2026-09-27 10:21:02
![1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane Structure](https://www.chemsrc.com/extcaspic/358/1595053-35-2.png)
1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane structure
|
Common Name | 1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane | ||
|---|---|---|---|---|
| CAS Number | 1595053-35-2 | Molecular Weight | 330.51 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H11ClF3IO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H11ClF3IO |
|---|---|
| Molecular Weight | 330.51 |
| InChIKey | LQMJTQCGHSLSKK-UHFFFAOYSA-N |
| SMILES | CC(OC(C)(CCl)CI)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1595053-35-2? |
| A: Chinese name of 1595053-35-2 is 1595053-35-2. |
| Q: What is the InChIKey of 1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane? |
| A: InChIKey of 1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane is LQMJTQCGHSLSKK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane? |
| A: SMILES notation of 1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane is CC(OC(C)(CCl)CI)C(F)(F)F. |
| Q: What is the English name of 1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane? |
| A: The English name of 1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane is 1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane. |
| Q: What is the CAS number of 1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane? |
| A: CAS number of 1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane is 1595053-35-2. |
| Q: What is the molecular weight of 1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane? |
| A: Molecular weight of 1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane is 330.51. |
| Q: What is the molecular formula of 1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane? |
| A: Molecular formula of 1-Chloro-3-iodo-2-methyl-2-[(1,1,1-trifluoropropan-2-yl)oxy]propane is C7H11ClF3IO. |