2-(2,6-Dichlorophenyl)-1,3-benzothiazole structure
|
Common Name | 2-(2,6-Dichlorophenyl)-1,3-benzothiazole | ||
|---|---|---|---|---|
| CAS Number | 15952-10-0 | Molecular Weight | 280.17200 | |
| Density | 1.433g/cm3 | Boiling Point | 419.8ºC at 760 mmHg | |
| Molecular Formula | C13H7Cl2NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.7ºC | |
| Name | 2-(2,6-Dichlorophenyl)-1,3-benzothiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.433g/cm3 |
|---|---|
| Boiling Point | 419.8ºC at 760 mmHg |
| Molecular Formula | C13H7Cl2NS |
| Molecular Weight | 280.17200 |
| Flash Point | 207.7ºC |
| Exact Mass | 278.96800 |
| PSA | 41.13000 |
| LogP | 5.27010 |
| Vapour Pressure | 7.23E-07mmHg at 25°C |
| Index of Refraction | 1.693 |
| InChIKey | JMMSLOVLIMWXDU-UHFFFAOYSA-N |
| SMILES | Clc1cccc(Cl)c1-c1nc2ccccc2s1 |
|
~43%
2-(2,6-Dichloro... CAS#:15952-10-0 |
| Literature: Zhong; Zhang; Chen Journal of the Indian Chemical Society, 2001 , vol. 78, # 6 p. 316 - 318 |
| Benzothiazole,2-(2,6-dichlorophenyl) |
| 2-(2,6-Dichlorophenyl)benzothiazole |