Benzenamine, 2,4-dibromo-N-(2-cyclopropyl-1-methylethyl)
Modify Date: 2025-09-09 13:21:08
Benzenamine, 2,4-dibromo-N-(2-cyclopropyl-1-methylethyl) structure
|
Common Name | Benzenamine, 2,4-dibromo-N-(2-cyclopropyl-1-methylethyl) | ||
|---|---|---|---|---|
| CAS Number | 1595716-60-1 | Molecular Weight | 333.06 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15Br2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzenamine, 2,4-dibromo-N-(2-cyclopropyl-1-methylethyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15Br2N |
|---|---|
| Molecular Weight | 333.06 |
| InChIKey | UHEMRZFFYROGQL-UHFFFAOYSA-N |
| SMILES | CC(CC1CC1)Nc1ccc(Br)cc1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Benzenamine, 2,4-dibromo-N-(2-cyclopropyl-1-methylethyl)? |
| A: SMILES notation of Benzenamine, 2,4-dibromo-N-(2-cyclopropyl-1-methylethyl) is CC(CC1CC1)Nc1ccc(Br)cc1Br. |
| Q: What is the CAS number of Benzenamine, 2,4-dibromo-N-(2-cyclopropyl-1-methylethyl)? |
| A: CAS number of Benzenamine, 2,4-dibromo-N-(2-cyclopropyl-1-methylethyl) is 1595716-60-1. |
| Q: What is the English name of Benzenamine, 2,4-dibromo-N-(2-cyclopropyl-1-methylethyl)? |
| A: The English name of Benzenamine, 2,4-dibromo-N-(2-cyclopropyl-1-methylethyl) is Benzenamine, 2,4-dibromo-N-(2-cyclopropyl-1-methylethyl). |
| Q: What is the molecular weight of Benzenamine, 2,4-dibromo-N-(2-cyclopropyl-1-methylethyl)? |
| A: Molecular weight of Benzenamine, 2,4-dibromo-N-(2-cyclopropyl-1-methylethyl) is 333.06. |
| Q: What is the Chinese name of 1595716-60-1? |
| A: Chinese name of 1595716-60-1 is 1595716-60-1. |
| Q: What is the InChIKey of Benzenamine, 2,4-dibromo-N-(2-cyclopropyl-1-methylethyl)? |
| A: InChIKey of Benzenamine, 2,4-dibromo-N-(2-cyclopropyl-1-methylethyl) is UHEMRZFFYROGQL-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Benzenamine, 2,4-dibromo-N-(2-cyclopropyl-1-methylethyl)? |
| A: Molecular formula of Benzenamine, 2,4-dibromo-N-(2-cyclopropyl-1-methylethyl) is C12H15Br2N. |