(1-(TERT-BUTYLDIMETHYLSILYL)-1H-INDOL-3-YL)BORONIC ACID structure
|
Common Name | (1-(TERT-BUTYLDIMETHYLSILYL)-1H-INDOL-3-YL)BORONIC ACID | ||
|---|---|---|---|---|
| CAS Number | 159590-02-0 | Molecular Weight | 275.22600 | |
| Density | 1.014g/cm3 | Boiling Point | 342.549ºC at 760 mmHg | |
| Molecular Formula | C14H22BNO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.968ºC | |
| Name | [1-[tert-butyl(dimethyl)silyl]indol-3-yl]boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.014g/cm3 |
|---|---|
| Boiling Point | 342.549ºC at 760 mmHg |
| Molecular Formula | C14H22BNO2Si |
| Molecular Weight | 275.22600 |
| Flash Point | 160.968ºC |
| Exact Mass | 275.15100 |
| PSA | 45.39000 |
| LogP | 2.17440 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.51 |
| InChIKey | GSNHHLNDEKIFIZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)n1cc(B(O)O)c2ccccc21 |
| HS Code | 2933990090 |
|---|
|
~%
(1-(TERT-BUTYLD... CAS#:159590-02-0 |
| Literature: Kawasaki, Ikuo; Katsuma, Hideo; Nakayama, Yohko; Yamashita, Masayuki; Ohta, Shunsaku Heterocycles, 1998 , vol. 48, # 9 p. 1887 - 1901 |
|
~%
(1-(TERT-BUTYLD... CAS#:159590-02-0 |
| Literature: Yang, Cai-Guang; Liu, Gang; Jiang, Biao Journal of Organic Chemistry, 2002 , vol. 67, # 26 p. 9392 - 9396 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (1-(tert-Butyldimethylsilyl)-1H-indol-3-yl)boronic acid |
| N-(tert-butyldimethylsilyl)indol-3-ylboronic acid |
| 3-[1-(tert-butyldimethylsilyl)indolyl]boronic acid |