2-Bromo-1,4-dichloro-3-(4,4,4-trifluorobutoxy)butane
Modify Date: 2025-09-09 17:43:13
2-Bromo-1,4-dichloro-3-(4,4,4-trifluorobutoxy)butane structure
|
Common Name | 2-Bromo-1,4-dichloro-3-(4,4,4-trifluorobutoxy)butane | ||
|---|---|---|---|---|
| CAS Number | 1595910-47-6 | Molecular Weight | 331.98 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H12BrCl2F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Bromo-1,4-dichloro-3-(4,4,4-trifluorobutoxy)butane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H12BrCl2F3O |
|---|---|
| Molecular Weight | 331.98 |
| InChIKey | YDHGOEJMIVAVQR-UHFFFAOYSA-N |
| SMILES | FC(F)(F)CCCOC(CCl)C(Br)CCl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-Bromo-1,4-dichloro-3-(4,4,4-trifluorobutoxy)butane? |
| A: CAS number of 2-Bromo-1,4-dichloro-3-(4,4,4-trifluorobutoxy)butane is 1595910-47-6. |
| Q: What is the molecular weight of 2-Bromo-1,4-dichloro-3-(4,4,4-trifluorobutoxy)butane? |
| A: Molecular weight of 2-Bromo-1,4-dichloro-3-(4,4,4-trifluorobutoxy)butane is 331.98. |
| Q: What is the English name of 2-Bromo-1,4-dichloro-3-(4,4,4-trifluorobutoxy)butane? |
| A: The English name of 2-Bromo-1,4-dichloro-3-(4,4,4-trifluorobutoxy)butane is 2-Bromo-1,4-dichloro-3-(4,4,4-trifluorobutoxy)butane. |
| Q: What is the Chinese name of 1595910-47-6? |
| A: Chinese name of 1595910-47-6 is 1595910-47-6. |
| Q: What is the InChIKey of 2-Bromo-1,4-dichloro-3-(4,4,4-trifluorobutoxy)butane? |
| A: InChIKey of 2-Bromo-1,4-dichloro-3-(4,4,4-trifluorobutoxy)butane is YDHGOEJMIVAVQR-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-Bromo-1,4-dichloro-3-(4,4,4-trifluorobutoxy)butane? |
| A: SMILES notation of 2-Bromo-1,4-dichloro-3-(4,4,4-trifluorobutoxy)butane is FC(F)(F)CCCOC(CCl)C(Br)CCl. |
| Q: What is the molecular formula of 2-Bromo-1,4-dichloro-3-(4,4,4-trifluorobutoxy)butane? |
| A: Molecular formula of 2-Bromo-1,4-dichloro-3-(4,4,4-trifluorobutoxy)butane is C8H12BrCl2F3O. |