4-(Bromomethyl)-4-(3,3-dimethylbutoxy)oxane structure
|
Common Name | 4-(Bromomethyl)-4-(3,3-dimethylbutoxy)oxane | ||
|---|---|---|---|---|
| CAS Number | 1595954-24-7 | Molecular Weight | 279.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H23BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(Bromomethyl)-4-(3,3-dimethylbutoxy)oxane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H23BrO2 |
|---|---|
| Molecular Weight | 279.21 |
| InChIKey | YGMABPXIUPBHLL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CCOC1(CBr)CCOCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-(Bromomethyl)-4-(3,3-dimethylbutoxy)oxane? |
| A: InChIKey of 4-(Bromomethyl)-4-(3,3-dimethylbutoxy)oxane is YGMABPXIUPBHLL-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1595954-24-7? |
| A: Chinese name of 1595954-24-7 is 1595954-24-7. |
| Q: What is the molecular weight of 4-(Bromomethyl)-4-(3,3-dimethylbutoxy)oxane? |
| A: Molecular weight of 4-(Bromomethyl)-4-(3,3-dimethylbutoxy)oxane is 279.21. |
| Q: What is the English name of 4-(Bromomethyl)-4-(3,3-dimethylbutoxy)oxane? |
| A: The English name of 4-(Bromomethyl)-4-(3,3-dimethylbutoxy)oxane is 4-(Bromomethyl)-4-(3,3-dimethylbutoxy)oxane. |
| Q: What is the SMILES notation of 4-(Bromomethyl)-4-(3,3-dimethylbutoxy)oxane? |
| A: SMILES notation of 4-(Bromomethyl)-4-(3,3-dimethylbutoxy)oxane is CC(C)(C)CCOC1(CBr)CCOCC1. |
| Q: What is the molecular formula of 4-(Bromomethyl)-4-(3,3-dimethylbutoxy)oxane? |
| A: Molecular formula of 4-(Bromomethyl)-4-(3,3-dimethylbutoxy)oxane is C12H23BrO2. |
| Q: What is the CAS number of 4-(Bromomethyl)-4-(3,3-dimethylbutoxy)oxane? |
| A: CAS number of 4-(Bromomethyl)-4-(3,3-dimethylbutoxy)oxane is 1595954-24-7. |