4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane
Modify Date: 2025-09-09 18:33:05
![4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane Structure](https://www.chemsrc.com/extcaspic/057/1596037-76-1.png)
4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane structure
|
Common Name | 4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane | ||
|---|---|---|---|---|
| CAS Number | 1596037-76-1 | Molecular Weight | 291.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14BrF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14BrF3O2 |
|---|---|
| Molecular Weight | 291.11 |
| InChIKey | HFOLFJGPPBFROH-UHFFFAOYSA-N |
| SMILES | CC(OC1(CBr)CCOCC1)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane? |
| A: Molecular formula of 4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane is C9H14BrF3O2. |
| Q: What is the SMILES notation of 4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane? |
| A: SMILES notation of 4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane is CC(OC1(CBr)CCOCC1)C(F)(F)F. |
| Q: What is the English name of 4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane? |
| A: The English name of 4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane is 4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane. |
| Q: What is the InChIKey of 4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane? |
| A: InChIKey of 4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane is HFOLFJGPPBFROH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane? |
| A: Molecular weight of 4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane is 291.11. |
| Q: What is the CAS number of 4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane? |
| A: CAS number of 4-(Bromomethyl)-4-[(1,1,1-trifluoropropan-2-yl)oxy]oxane is 1596037-76-1. |
| Q: What is the Chinese name of 1596037-76-1? |
| A: Chinese name of 1596037-76-1 is 1596037-76-1. |