(1R,2S)-1-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-ethenylcyclopropanecarboxylic acid methyl ester structure
|
Common Name | (1R,2S)-1-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-ethenylcyclopropanecarboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 159622-09-0 | Molecular Weight | 241.284 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 312.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.6±27.9 °C | |
| Name | methyl (1R,2S)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 312.3±42.0 °C at 760 mmHg |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.284 |
| Flash Point | 142.6±27.9 °C |
| Exact Mass | 241.131409 |
| PSA | 68.12000 |
| LogP | 2.24 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.484 |
| InChIKey | MMSKTMKTGVHMAV-PRHODGIISA-N |
| SMILES | C=CC1CC1(NC(=O)OC(C)(C)C)C(=O)OC |
|
~%
(1R,2S)-1-[[(1,... CAS#:159622-09-0 |
| Literature: Beaulieu, Pierre L.; Gillard, James; Bailey, Murray D.; Boucher, Colette; Duceppe, Jean-Simon; Simoneau, Bruno; Wang, Xiao-Jun; Zhang, Li; Grozinger, Karl; Houpis, Ioannis; Farina, Vittorio; Heimroth, Heidi; Krueger, Thomas; Schnaubelt, Juergen Journal of Organic Chemistry, 2005 , vol. 70, # 15 p. 5869 - 5879 |
|
~%
(1R,2S)-1-[[(1,... CAS#:159622-09-0 |
| Literature: Fliche; Braun; Le Goffic Synthetic Communications, 1994 , vol. 24, # 20 p. 2873 - 2876 |
|
~%
(1R,2S)-1-[[(1,... CAS#:159622-09-0 |
| Literature: Fliche; Braun; Le Goffic Synthetic Communications, 1994 , vol. 24, # 20 p. 2873 - 2876 |
|
~%
(1R,2S)-1-[[(1,... CAS#:159622-09-0 |
| Literature: Fliche; Braun; Le Goffic Synthetic Communications, 1994 , vol. 24, # 20 p. 2873 - 2876 |
| N-Boc-(1R,2S)-1-amino-2-vinylcyclopropane carboxylic acid methyl ester |
| (1R,2S)-methyl 1-t-butoxycarbonylamino-2-vinylcyclopropane carboxylate |
| CYC032 |
| N-Boc-vinyl-ACCA-OMe |
| (1R,2S)-1-tert-butoxycarbonylamino-2-vinyl-cyclopropanecarboxylic acid methyl ester |
| Cyclopropanecarboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]-2-ethenyl-, methyl ester, (1R,2S)- |
| (1R,2S)-ethyl 1-[(tert-butoxycarbonyl)amino]-2-ethenylcyclopropanecarboxylate |
| (1R,2S)-Methyl 1-((tert-butoxycarbonyl)amino)-2-vinylcyclopropanecarboxylate |
| methyl (1R,2S)-1-[(tert-butoxycarbonyl)amino]-2-vinylcyclopropanecarboxylate |
| Methyl-(1R,2S)-1-[(tert-butoxycarbonyl)amino]-2-vinylcyclopropancarboxylat |
| Methyl (1R,2S)-1-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-2-vinylcyclopropanecarboxylate |
| (1R,2S)-1-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-ethenylcyclopropanecarboxylic acid methyl ester |